C27H37NO4 — CID 90945604
4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-propylbutanamide (PubChem CID 90945604) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-propylbutanamide.
| Compound Name | 4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-propylbutanamide |
|---|---|
| PubChem CID | 90945604 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-propylbutanamide |
| SMILES | CC#CC[C@@H](C)[C@H](O)C=C[C@@H]1[C@H]2c3cccc(CCCC(=O)NCCC)c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H37NO4/c1-4-6-9-18(3)22(29)15-14-20-23(30)17-24-26(20)21-12-7-10-19(27(21)32-24)11-8-13-25(31)28-16-5-2/h7,10,12,14-15,18,20,22-24,26,29-30H,5,8-9,11,13,16-17H2,1-3H3,(H,28,31)/t18-,20+,22-,23-,24+,26+/m1/s1 |
| InChIKey | MQXPAQKWBLMNRM-WPTVHCKSSA-N |
| XLogP | 3.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|