C28H41NO3 — CID 91212982
(1R,2R,3aS,8bS)-5-[4-(butylamino)butyl]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol (PubChem CID 91212982) has the molecular formula C28H41NO3 and a molecular weight of 439.64 g/mol. Its IUPAC name is (1R,2R,3aS,8bS)-5-[4-(butylamino)butyl]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol.
| Compound Name | (1R,2R,3aS,8bS)-5-[4-(butylamino)butyl]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
|---|---|
| PubChem CID | 91212982 |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | (1R,2R,3aS,8bS)-5-[4-(butylamino)butyl]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-ol |
| SMILES | CC#CC[C@@H](C)[C@H](O)C=C[C@@H]1[C@H]2c3cccc(CCCCNCCCC)c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C28H41NO3/c1-4-6-11-20(3)24(30)16-15-22-25(31)19-26-27(22)23-14-10-13-21(28(23)32-26)12-8-9-18-29-17-7-5-2/h10,13-16,20,22,24-27,29-31H,5,7-9,11-12,17-19H2,1-3H3/t20-,22+,24-,25-,26+,27+/m1/s1 |
| InChIKey | PPUZVJHLDGKMDN-SRMYGSHLSA-N |
| XLogP | 4.59 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|