C33H40O7 — CID 90215605
(2,4-dimethoxyphenyl)methyl 4-[(1R,3aS,8bS)-2-hydroxy-1-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate (PubChem CID 90215605) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl 4-[(1R,3aS,8bS)-2-hydroxy-1-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate.
| Compound Name | (2,4-dimethoxyphenyl)methyl 4-[(1R,3aS,8bS)-2-hydroxy-1-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
|---|---|
| PubChem CID | 90215605 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl 4-[(1R,3aS,8bS)-2-hydroxy-1-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
| SMILES | CC#CCC(C)[C@H](O)/C=C/[C@H]1C(O)C[C@@H]2Oc3c(CCCC(=O)OCc4ccc(OC)cc4OC)cccc3[C@@H]21 |
| InChI | InChI=1S/C33H40O7/c1-5-6-9-21(2)27(34)17-16-25-28(35)19-30-32(25)26-12-7-10-22(33(26)40-30)11-8-13-31(36)39-20-23-14-15-24(37-3)18-29(23)38-4/h7,10,12,14-18,21,25,27-28,30,32,34-35H,8-9,11,13,19-20H2,1-4H3/b17-16+/t21?,25-,27+,28?,30-,32-/m0/s1 |
| InChIKey | IRZCAKXELBCUCF-FYZVYRJWSA-N |
| XLogP | 4.96 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|