C30H35NO4 — CID 91115239
4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-phenylbutanamide (PubChem CID 91115239) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is 4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-phenylbutanamide.
| Compound Name | 4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-phenylbutanamide |
|---|---|
| PubChem CID | 91115239 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 4-[(1R,2R,3aS,8bS)-2-hydroxy-1-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N-phenylbutanamide |
| SMILES | CC#CC[C@H](C)[C@H](O)C=C[C@@H]1[C@H]2c3cccc(CCCC(=O)Nc4ccccc4)c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C30H35NO4/c1-3-4-10-20(2)25(32)18-17-23-26(33)19-27-29(23)24-15-8-11-21(30(24)35-27)12-9-16-28(34)31-22-13-6-5-7-14-22/h5-8,11,13-15,17-18,20,23,25-27,29,32-33H,9-10,12,16,19H2,1-2H3,(H,31,34)/t20-,23-,25+,26+,27-,29-/m0/s1 |
| InChIKey | RKWNHNGPQGUGHY-QUSFPEFVSA-N |
| XLogP | 4.84 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|