C26H35NO4S — CID 142043463
4-[2-hydroxy-1-[(E)-3-(hydroxymethyl)-4-sulfanyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N,N-dimethylbutanamide (PubChem CID 142043463) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 4-[2-hydroxy-1-[(E)-3-(hydroxymethyl)-4-sulfanyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N,N-dimethylbutanamide.
| Compound Name | 4-[2-hydroxy-1-[(E)-3-(hydroxymethyl)-4-sulfanyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 142043463 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 4-[2-hydroxy-1-[(E)-3-(hydroxymethyl)-4-sulfanyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]-N,N-dimethylbutanamide |
| SMILES | CC#CCC(S)C(/C=C/C1C(O)CC2Oc3c(CCCC(=O)N(C)C)cccc3C21)CO |
| InChI | InChI=1S/C26H35NO4S/c1-4-5-11-23(32)18(16-28)13-14-19-21(29)15-22-25(19)20-10-6-8-17(26(20)31-22)9-7-12-24(30)27(2)3/h6,8,10,13-14,18-19,21-23,25,28-29,32H,7,9,11-12,15-16H2,1-3H3/b14-13+ |
| InChIKey | FUHUFKLUMXZFPP-BUHFOSPRSA-N |
| XLogP | 3.20 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|