C23H37NO6 — CID 70607834
7-[7-carbamoyl-8-(3-hydroxyoct-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid (PubChem CID 70607834) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is 7-[7-carbamoyl-8-(3-hydroxyoct-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid.
| Compound Name | 7-[7-carbamoyl-8-(3-hydroxyoct-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70607834 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 7-[7-carbamoyl-8-(3-hydroxyoct-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
| SMILES | CCCCCC(O)C=CC1C(C(N)=O)CC2(OCCO2)C1CC=CCCCC(=O)O |
| InChI | InChI=1S/C23H37NO6/c1-2-3-6-9-17(25)12-13-18-19(22(24)28)16-23(29-14-15-30-23)20(18)10-7-4-5-8-11-21(26)27/h4,7,12-13,17-20,25H,2-3,5-6,8-11,14-16H2,1H3,(H2,24,28)(H,26,27) |
| InChIKey | SLSFMQMJTQRARR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|