C34H39FO4Si — CID 67857576
methyl (Z)-4-[(1S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoate (PubChem CID 67857576) has the molecular formula C34H39FO4Si and a molecular weight of 558.77 g/mol. Its IUPAC name is methyl (Z)-4-[(1S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoate.
| Compound Name | methyl (Z)-4-[(1S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 67857576 |
| Molecular Formula | C34H39FO4Si |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | methyl (Z)-4-[(1S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoate |
| SMILES | COC(=O)/C=C\C[C@H]1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2C[C@@]1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C34H39FO4Si/c1-33(2,3)40(27-12-7-5-8-13-27,28-14-9-6-10-15-28)39-23-29-30(16-11-17-32(36)37-4)34(22-31(29)38-24-34)25-18-20-26(35)21-19-25/h5-15,17-21,29-31H,16,22-24H2,1-4H3/b17-11-/t29-,30-,31-,34-/m0/s1 |
| InChIKey | IGWVYBOANSYMDY-PNTNPLOZSA-N |
| XLogP | 5.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|