C24H31BrO4Si — CID 58645450
[2-(bromomethyl)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl] 2-methoxyacetate (PubChem CID 58645450) has the molecular formula C24H31BrO4Si and a molecular weight of 491.50 g/mol. Its IUPAC name is [2-(bromomethyl)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl] 2-methoxyacetate.
| Compound Name | [2-(bromomethyl)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 58645450 |
| Molecular Formula | C24H31BrO4Si |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [2-(bromomethyl)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl] 2-methoxyacetate |
| SMILES | COCC(=O)OC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1CBr |
| InChI | InChI=1S/C24H31BrO4Si/c1-23(2,3)30(20-11-7-5-8-12-20,21-13-9-6-10-14-21)28-18-24(15-19(24)16-25)29-22(26)17-27-4/h5-14,19H,15-18H2,1-4H3 |
| InChIKey | RYCXJCYIPMAADS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|