C31H40N2O3SSi — CID 10626460
1-benzyl-3-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]thiourea (PubChem CID 10626460) has the molecular formula C31H40N2O3SSi and a molecular weight of 548.83 g/mol. Its IUPAC name is 1-benzyl-3-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]thiourea.
| Compound Name | 1-benzyl-3-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]thiourea |
|---|---|
| PubChem CID | 10626460 |
| Molecular Formula | C31H40N2O3SSi |
| Molecular Weight | 548.83 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 1-benzyl-3-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]thiourea |
| SMILES | CC1(C)OC[C@@H](NC(=S)NCc2ccccc2)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H40N2O3SSi/c1-30(2,3)38(25-17-11-7-12-18-25,26-19-13-8-14-20-26)35-23-28-27(22-34-31(4,5)36-28)33-29(37)32-21-24-15-9-6-10-16-24/h6-20,27-28H,21-23H2,1-5H3,(H2,32,33,37)/t27-,28+/m1/s1 |
| InChIKey | QJXSUAVKUQZKGS-IZLXSDGUSA-N |
| XLogP | 4.75 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|