C22H29O6P — CID 10645786
(1S)-3-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol (PubChem CID 10645786) has the molecular formula C22H29O6P and a molecular weight of 420.44 g/mol. Its IUPAC name is (1S)-3-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol.
| Compound Name | (1S)-3-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 10645786 |
| Molecular Formula | C22H29O6P |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (1S)-3-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
| SMILES | CC1(C)OC[C@H]([C@@H](O)CCP(=O)(OCc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C22H29O6P/c1-22(2)25-17-21(28-22)20(23)13-14-29(24,26-15-18-9-5-3-6-10-18)27-16-19-11-7-4-8-12-19/h3-12,20-21,23H,13-17H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | RKZDFMQXBRMZQQ-LEWJYISDSA-N |
| XLogP | 4.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|