C18H22O6 — CID 56647675
benzyl [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynyl] carbonate (PubChem CID 56647675) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is benzyl [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynyl] carbonate.
| Compound Name | benzyl [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynyl] carbonate |
|---|---|
| PubChem CID | 56647675 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | benzyl [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynyl] carbonate |
| SMILES | CC1(C)OC[C@H](C(O)CC#CCOC(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C18H22O6/c1-18(2)23-13-16(24-18)15(19)10-6-7-11-21-17(20)22-12-14-8-4-3-5-9-14/h3-5,8-9,15-16,19H,10-13H2,1-2H3/t15?,16-/m1/s1 |
| InChIKey | SDSPBVWKLJPEHS-OEMAIJDKSA-N |
| XLogP | 2.25 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|