C20H27NO3S — CID 11279910
O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenylhex-2-ynyl] N,N-dimethylcarbamothioate (PubChem CID 11279910) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenylhex-2-ynyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenylhex-2-ynyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 11279910 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenylhex-2-ynyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)O[C@@H](C#CCCCc1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H27NO3S/c1-20(2)22-15-18(24-20)17(23-19(25)21(3)4)14-10-6-9-13-16-11-7-5-8-12-16/h5,7-8,11-12,17-18H,6,9,13,15H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | VZURAAYQBJQKLA-ZWKOTPCHSA-N |
| XLogP | 3.40 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|