C25H28O8 — CID 11123320
[(2R,3S)-3-benzoyloxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethoxy-4-oxobutan-2-yl] benzoate (PubChem CID 11123320) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is [(2R,3S)-3-benzoyloxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethoxy-4-oxobutan-2-yl] benzoate.
| Compound Name | [(2R,3S)-3-benzoyloxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethoxy-4-oxobutan-2-yl] benzoate |
|---|---|
| PubChem CID | 11123320 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [(2R,3S)-3-benzoyloxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethoxy-4-oxobutan-2-yl] benzoate |
| SMILES | CCOC(=O)[C@@H](OC(=O)c1ccccc1)[C@@H](C[C@H]1COC(C)(C)O1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O8/c1-4-29-24(28)21(32-23(27)18-13-9-6-10-14-18)20(15-19-16-30-25(2,3)33-19)31-22(26)17-11-7-5-8-12-17/h5-14,19-21H,4,15-16H2,1-3H3/t19-,20+,21-/m0/s1 |
| InChIKey | DJMCDDLRIFSHKR-HBMCJLEFSA-N |
| XLogP | 3.54 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|