C24H30Cl3NO8 — CID 134973253
[(4R,5S)-5-[(4R,5R)-4-[(1S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyethyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate (PubChem CID 134973253) has the molecular formula C24H30Cl3NO8 and a molecular weight of 566.86 g/mol. Its IUPAC name is [(4R,5S)-5-[(4R,5R)-4-[(1S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyethyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate.
| Compound Name | [(4R,5S)-5-[(4R,5R)-4-[(1S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyethyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 134973253 |
| Molecular Formula | C24H30Cl3NO8 |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | [(4R,5S)-5-[(4R,5R)-4-[(1S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyethyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate |
| SMILES | CC1(C)OC[C@H](C[C@H](O)[C@H]2N=C(C(Cl)(Cl)Cl)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]2COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C24H30Cl3NO8/c1-22(2)32-11-14(34-22)10-15(29)17-19(33-21(28-17)24(25,26)27)18-16(35-23(3,4)36-18)12-31-20(30)13-8-6-5-7-9-13/h5-9,14-19,29H,10-12H2,1-4H3/t14-,15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | NSNZQAUPCWANOX-GRUVHVDGSA-N |
| XLogP | 3.80 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|