About actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate
actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate (PubChem CID 59070581) has the molecular formula C8H14AcO4S
and a molecular weight of 433.26 g/mol. Its IUPAC name is actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate.
Analyze actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate?
The IUPAC name of actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate (CID 59070581) is actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate.
What is the SMILES notation for actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate?
The canonical SMILES for actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate is CCCC(=O)OC[C@@H]1OC(O)CS1.[Ac].
What is the InChIKey of actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate?
The InChIKey is SQGIGEXTAKLSLL-LTTWWRRRSA-N. The full InChI is InChI=1S/C8H14O4S.Ac/c1-2-3-6(9)11-4-8-12-7(10)5-13-8;/h7-8,10H,2-5H2,1H3;/t7?,8-;/m1./s1.
What are the key properties of actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate?
actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate has a molecular weight of 433.26 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;[(2R)-5-hydroxy-1,3-oxathiolan-2-yl]methyl butanoate is sourced from PubChem (CID 59070581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).