C10H14O8 — CID 25132626
dimethyl (2R,3R,5R)-5-acetyloxy-1,4-dioxane-2,3-dicarboxylate (PubChem CID 25132626) has the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. Its IUPAC name is dimethyl (2R,3R,5R)-5-acetyloxy-1,4-dioxane-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3R,5R)-5-acetyloxy-1,4-dioxane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 25132626 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | dimethyl (2R,3R,5R)-5-acetyloxy-1,4-dioxane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1OC[C@@H](OC(C)=O)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C10H14O8/c1-5(11)17-6-4-16-7(9(12)14-2)8(18-6)10(13)15-3/h6-8H,4H2,1-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | DWIOYEHECROSSD-XLPZGREQSA-N |
| XLogP | -0.99 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|