C11H16O7S — CID 166816239
2-oxo-2-(4-prop-2-enoyloxycyclohexyl)oxyethanesulfonic acid (PubChem CID 166816239) has the molecular formula C11H16O7S and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-oxo-2-(4-prop-2-enoyloxycyclohexyl)oxyethanesulfonic acid.
| Compound Name | 2-oxo-2-(4-prop-2-enoyloxycyclohexyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166816239 |
| Molecular Formula | C11H16O7S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-oxo-2-(4-prop-2-enoyloxycyclohexyl)oxyethanesulfonic acid |
| SMILES | C=CC(=O)OC1CCC(OC(=O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C11H16O7S/c1-2-10(12)17-8-3-5-9(6-4-8)18-11(13)7-19(14,15)16/h2,8-9H,1,3-7H2,(H,14,15,16) |
| InChIKey | ITWFIEUSMRZSBE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|