C8H4F6O5 — CID 87675460
(4,4,4-trifluoro-3-oxobutanoyl) 4,4,4-trifluoro-3-oxobutanoate (PubChem CID 87675460) has the molecular formula C8H4F6O5 and a molecular weight of 294.10 g/mol. Its IUPAC name is (4,4,4-trifluoro-3-oxobutanoyl) 4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | (4,4,4-trifluoro-3-oxobutanoyl) 4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 87675460 |
| Molecular Formula | C8H4F6O5 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | (4,4,4-trifluoro-3-oxobutanoyl) 4,4,4-trifluoro-3-oxobutanoate |
| SMILES | O=C(CC(=O)C(F)(F)F)OC(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H4F6O5/c9-7(10,11)3(15)1-5(17)19-6(18)2-4(16)8(12,13)14/h1-2H2 |
| InChIKey | FHCVXRUNACSMBR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|