C9H16F2O3 — CID 58239498
tert-butyl 2,2-difluoro-3-hydroxypentanoate (PubChem CID 58239498) has the molecular formula C9H16F2O3 and a molecular weight of 210.22 g/mol. Its IUPAC name is tert-butyl 2,2-difluoro-3-hydroxypentanoate.
| Compound Name | tert-butyl 2,2-difluoro-3-hydroxypentanoate |
|---|---|
| PubChem CID | 58239498 |
| Molecular Formula | C9H16F2O3 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | tert-butyl 2,2-difluoro-3-hydroxypentanoate |
| SMILES | CCC(O)C(F)(F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H16F2O3/c1-5-6(12)9(10,11)7(13)14-8(2,3)4/h6,12H,5H2,1-4H3 |
| InChIKey | BHMZQORARLZZHU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |