C11H20F2O5 — CID 143620723
ethyl 2,2-difluoro-3-hydroxy-5-(2-methoxypropan-2-yloxy)pentanoate (PubChem CID 143620723) has the molecular formula C11H20F2O5 and a molecular weight of 270.27 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-hydroxy-5-(2-methoxypropan-2-yloxy)pentanoate.
| Compound Name | ethyl 2,2-difluoro-3-hydroxy-5-(2-methoxypropan-2-yloxy)pentanoate |
|---|---|
| PubChem CID | 143620723 |
| Molecular Formula | C11H20F2O5 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | ethyl 2,2-difluoro-3-hydroxy-5-(2-methoxypropan-2-yloxy)pentanoate |
| SMILES | CCOC(=O)C(F)(F)C(O)CCOC(C)(C)OC |
| InChI | InChI=1S/C11H20F2O5/c1-5-17-9(15)11(12,13)8(14)6-7-18-10(2,3)16-4/h8,14H,5-7H2,1-4H3 |
| InChIKey | UXMFKABUPMFRDQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|