C22H27F11O3 — CID 162347303
(2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-methyloctanoate (PubChem CID 162347303) has the molecular formula C22H27F11O3 and a molecular weight of 548.43 g/mol. Its IUPAC name is (2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-methyloctanoate.
| Compound Name | (2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-methyloctanoate |
|---|---|
| PubChem CID | 162347303 |
| Molecular Formula | C22H27F11O3 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | (2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-methyloctanoate |
| SMILES | CC(C)C1(OC(=O)C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H27F11O3/c1-10(2)18(13-5-11-4-12(7-13)8-14(18)6-11)36-15(34)16(3,35)9-17(23,24)19(25,26)20(27,28)21(29,30)22(31,32)33/h10-14,35H,4-9H2,1-3H3 |
| InChIKey | PKNPZHJSCSNKBV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|