C39H49F13O11 — CID 158039792
(2-methyl-2-adamantyl) prop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate (PubChem CID 158039792) has the molecular formula C39H49F13O11 and a molecular weight of 940.78 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) prop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate.
| Compound Name | (2-methyl-2-adamantyl) prop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate |
|---|---|
| PubChem CID | 158039792 |
| Molecular Formula | C39H49F13O11 |
| Molecular Weight | 940.78 g/mol |
| Exact Mass | 940.31 |
| IUPAC Name | (2-methyl-2-adamantyl) prop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate |
| SMILES | C=CC(=O)OC1(C)C2CC3CC(C2)CC1C3.C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.C=CC(=O)OCCOCCOCCOCCOC(=O)C=C |
| InChI | InChI=1S/C14H22O7.C14H20O2.C11H7F13O2/c1-3-13(15)20-11-9-18-7-5-17-6-8-19-10-12-21-14(16)4-2;1-3-13(15)16-14(2)11-5-9-4-10(7-11)8-12(14)6-9;1-2-5(25)26-4-3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h3-4H,1-2,5-12H2;3,9-12H,1,4-8H2,2H3;2H,1,3-4H2 |
| InChIKey | FIFAHFKWNBHPSG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.78 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|