C29H33F11O3 — CID 162347471
(2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-(2-phenylethyl)octanoate (PubChem CID 162347471) has the molecular formula C29H33F11O3 and a molecular weight of 638.56 g/mol. Its IUPAC name is (2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-(2-phenylethyl)octanoate.
| Compound Name | (2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-(2-phenylethyl)octanoate |
|---|---|
| PubChem CID | 162347471 |
| Molecular Formula | C29H33F11O3 |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | (2-propan-2-yl-2-adamantyl) 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxy-2-(2-phenylethyl)octanoate |
| SMILES | CC(C)C1(OC(=O)C(O)(CCc2ccccc2)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C29H33F11O3/c1-16(2)25(20-11-18-10-19(13-20)14-21(25)12-18)43-22(41)23(42,9-8-17-6-4-3-5-7-17)15-24(30,31)26(32,33)27(34,35)28(36,37)29(38,39)40/h3-7,16,18-21,42H,8-15H2,1-2H3 |
| InChIKey | CMVVLRVBRMAQSG-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|