C29H25F17N2O — CID 15953624
(5S)-5-benzyl-3-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl]-2,2-dimethylimidazolidin-4-one (PubChem CID 15953624) has the molecular formula C29H25F17N2O and a molecular weight of 740.50 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl]-2,2-dimethylimidazolidin-4-one.
| Compound Name | (5S)-5-benzyl-3-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl]-2,2-dimethylimidazolidin-4-one |
|---|---|
| PubChem CID | 15953624 |
| Molecular Formula | C29H25F17N2O |
| Molecular Weight | 740.50 g/mol |
| Exact Mass | 740.17 |
| IUPAC Name | (5S)-5-benzyl-3-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl]-2,2-dimethylimidazolidin-4-one |
| SMILES | CC1(C)N[C@@H](Cc2ccccc2)C(=O)N1Cc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H25F17N2O/c1-21(2)47-19(14-17-6-4-3-5-7-17)20(49)48(21)15-18-10-8-16(9-11-18)12-13-22(30,31)23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)28(42,43)29(44,45)46/h3-11,19,47H,12-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | HUAAOAAEZACGGA-IBGZPJMESA-N |
| XLogP | 8.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.50 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|