C14H8ClF23Si — CID 90932983
chloro-dimethyl-(1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecyl)silane (PubChem CID 90932983) has the molecular formula C14H8ClF23Si and a molecular weight of 676.71 g/mol. Its IUPAC name is chloro-dimethyl-(1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecyl)silane.
| Compound Name | chloro-dimethyl-(1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecyl)silane |
|---|---|
| PubChem CID | 90932983 |
| Molecular Formula | C14H8ClF23Si |
| Molecular Weight | 676.71 g/mol |
| Exact Mass | 675.97 |
| IUPAC Name | chloro-dimethyl-(1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecyl)silane |
| SMILES | C[Si](C)(Cl)C(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8ClF23Si/c1-39(2,15)5(18,19)3-4(16,17)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)12(32,33)13(34,35)14(36,37)38/h3H2,1-2H3 |
| InChIKey | HGYZGNXGGOQXEA-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.71 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|