C18H12F9I — CID 151788080
(3,3,4,4,5,5,6,6,6-nonafluoro-1-iodo-1-phenylhexyl)benzene (PubChem CID 151788080) has the molecular formula C18H12F9I and a molecular weight of 526.18 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,6-nonafluoro-1-iodo-1-phenylhexyl)benzene.
| Compound Name | (3,3,4,4,5,5,6,6,6-nonafluoro-1-iodo-1-phenylhexyl)benzene |
|---|---|
| PubChem CID | 151788080 |
| Molecular Formula | C18H12F9I |
| Molecular Weight | 526.18 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | (3,3,4,4,5,5,6,6,6-nonafluoro-1-iodo-1-phenylhexyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H12F9I/c19-15(20,16(21,22)17(23,24)18(25,26)27)11-14(28,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | RWAOFJLFEKWBET-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.18 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|