C22H12F19P — CID 87504522
(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-1,1-diphenyldecyl)phosphane (PubChem CID 87504522) has the molecular formula C22H12F19P and a molecular weight of 668.27 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-1,1-diphenyldecyl)phosphane.
| Compound Name | (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-1,1-diphenyldecyl)phosphane |
|---|---|
| PubChem CID | 87504522 |
| Molecular Formula | C22H12F19P |
| Molecular Weight | 668.27 g/mol |
| Exact Mass | 668.04 |
| IUPAC Name | (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-1,1-diphenyldecyl)phosphane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(P)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H12F19P/c23-14(24,13(42,11-7-3-1-4-8-11)12-9-5-2-6-10-12)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)21(37,38)22(39,40)41/h1-10H,42H2 |
| InChIKey | CKYYCXFLFXAKHB-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.27 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|