About 1-fluoro-4-phenylbenzene
1-fluoro-4-phenylbenzene (PubChem CID 9461) has the molecular formula C12H9F
and a molecular weight of 172.20 g/mol. Its IUPAC name is 1-fluoro-4-phenylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-4-phenylbenzene |
| PubChem CID | 9461 |
| Molecular Formula | C12H9F |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-fluoro-4-phenylbenzene |
| SMILES | Fc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9F/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | RUYZJEIKQYLEGZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-phenylbenzene?
The IUPAC name of 1-fluoro-4-phenylbenzene (CID 9461) is 1-fluoro-4-phenylbenzene.
What is the SMILES notation for 1-fluoro-4-phenylbenzene?
The canonical SMILES for 1-fluoro-4-phenylbenzene is Fc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-fluoro-4-phenylbenzene?
The InChIKey is RUYZJEIKQYLEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H.
What are the key properties of 1-fluoro-4-phenylbenzene?
1-fluoro-4-phenylbenzene has a molecular weight of 172.20 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-phenylbenzene is sourced from PubChem (CID 9461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).