C19H12F11I — CID 153324331
[3,4,4,5,5,6,6,6-octafluoro-1-iodo-1-phenyl-3-(trifluoromethyl)hexyl]benzene (PubChem CID 153324331) has the molecular formula C19H12F11I and a molecular weight of 576.19 g/mol. Its IUPAC name is [3,4,4,5,5,6,6,6-octafluoro-1-iodo-1-phenyl-3-(trifluoromethyl)hexyl]benzene.
| Compound Name | [3,4,4,5,5,6,6,6-octafluoro-1-iodo-1-phenyl-3-(trifluoromethyl)hexyl]benzene |
|---|---|
| PubChem CID | 153324331 |
| Molecular Formula | C19H12F11I |
| Molecular Weight | 576.19 g/mol |
| Exact Mass | 575.98 |
| IUPAC Name | [3,4,4,5,5,6,6,6-octafluoro-1-iodo-1-phenyl-3-(trifluoromethyl)hexyl]benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(CC(I)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H12F11I/c20-15(18(25,26)27,16(21,22)17(23,24)19(28,29)30)11-14(31,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | MKKNDKZSNYNSLW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.19 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|