C9H7F5 — CID 124636792
[(2R)-1,1,1,2,3-pentafluoropropan-2-yl]benzene (PubChem CID 124636792) has the molecular formula C9H7F5 and a molecular weight of 210.15 g/mol. Its IUPAC name is [(2R)-1,1,1,2,3-pentafluoropropan-2-yl]benzene.
| Compound Name | [(2R)-1,1,1,2,3-pentafluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 124636792 |
| Molecular Formula | C9H7F5 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | [(2R)-1,1,1,2,3-pentafluoropropan-2-yl]benzene |
| SMILES | FC[C@](F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H7F5/c10-6-8(11,9(12,13)14)7-4-2-1-3-5-7/h1-5H,6H2/t8-/m0/s1 |
| InChIKey | GUVTZTNJOUZPIS-QMMMGPOBSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |