C10H11F4N — CID 84735274
2,3,3,3-tetrafluoro-N-methyl-2-phenylpropan-1-amine (PubChem CID 84735274) has the molecular formula C10H11F4N and a molecular weight of 221.20 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-N-methyl-2-phenylpropan-1-amine.
| Compound Name | 2,3,3,3-tetrafluoro-N-methyl-2-phenylpropan-1-amine |
|---|---|
| PubChem CID | 84735274 |
| Molecular Formula | C10H11F4N |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2,3,3,3-tetrafluoro-N-methyl-2-phenylpropan-1-amine |
| SMILES | CNCC(F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H11F4N/c1-15-7-9(11,10(12,13)14)8-5-3-2-4-6-8/h2-6,15H,7H2,1H3 |
| InChIKey | HFNGLGOUEHDWMQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |