C7H12F3IO2 — CID 143906741
4-iodo-4-methyl-2-(trifluoromethyl)pentane-1,2-diol (PubChem CID 143906741) has the molecular formula C7H12F3IO2 and a molecular weight of 312.07 g/mol. Its IUPAC name is 4-iodo-4-methyl-2-(trifluoromethyl)pentane-1,2-diol.
| Compound Name | 4-iodo-4-methyl-2-(trifluoromethyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 143906741 |
| Molecular Formula | C7H12F3IO2 |
| Molecular Weight | 312.07 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 4-iodo-4-methyl-2-(trifluoromethyl)pentane-1,2-diol |
| SMILES | CC(C)(I)CC(O)(CO)C(F)(F)F |
| InChI | InChI=1S/C7H12F3IO2/c1-5(2,11)3-6(13,4-12)7(8,9)10/h12-13H,3-4H2,1-2H3 |
| InChIKey | MLZXUWDWBXCWMG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.07 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|