About CID 89029393
CID 89029393 (PubChem CID 89029393) has the molecular formula C4H4BF4IO
and a molecular weight of 281.78 g/mol.
Molecular Properties
| Compound Name | CID 89029393 |
| PubChem CID | 89029393 |
| Molecular Formula | C4H4BF4IO |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | — |
| SMILES | [B]C(O)(C(F)(F)F)C(C)(F)I |
| InChI | InChI=1S/C4H4BF4IO/c1-2(6,10)3(5,11)4(7,8)9/h11H,1H3 |
| InChIKey | PPSLVYRZPPIQJR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 89029393 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89029393?
The IUPAC name of CID 89029393 (CID 89029393) is not available.
What is the SMILES notation for CID 89029393?
The canonical SMILES for CID 89029393 is [B]C(O)(C(F)(F)F)C(C)(F)I.
What is the InChIKey of CID 89029393?
The InChIKey is PPSLVYRZPPIQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BF4IO/c1-2(6,10)3(5,11)4(7,8)9/h11H,1H3.
What are the key properties of CID 89029393?
CID 89029393 has a molecular weight of 281.78 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89029393 is sourced from PubChem (CID 89029393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).