C11H24O9 — CID 175345676
2,4-bis(hydroxymethyl)-3-methyl-3-(1,2,3-trihydroxypropan-2-yl)pentane-1,2,4,5-tetrol (PubChem CID 175345676) has the molecular formula C11H24O9 and a molecular weight of 300.30 g/mol. Its IUPAC name is 2,4-bis(hydroxymethyl)-3-methyl-3-(1,2,3-trihydroxypropan-2-yl)pentane-1,2,4,5-tetrol.
| Compound Name | 2,4-bis(hydroxymethyl)-3-methyl-3-(1,2,3-trihydroxypropan-2-yl)pentane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 175345676 |
| Molecular Formula | C11H24O9 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,4-bis(hydroxymethyl)-3-methyl-3-(1,2,3-trihydroxypropan-2-yl)pentane-1,2,4,5-tetrol |
| SMILES | CC(C(O)(CO)CO)(C(O)(CO)CO)C(O)(CO)CO |
| InChI | InChI=1S/C11H24O9/c1-8(9(18,2-12)3-13,10(19,4-14)5-15)11(20,6-16)7-17/h12-20H,2-7H2,1H3 |
| InChIKey | UBLXHJYQPIPIBP-UHFFFAOYSA-N |
| XLogP | -4.86 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |