C12H14O3 — CID 175708652
2,3-bis(prop-2-ynyl)hex-5-yne-1,2,3-triol (PubChem CID 175708652) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,3-bis(prop-2-ynyl)hex-5-yne-1,2,3-triol.
| Compound Name | 2,3-bis(prop-2-ynyl)hex-5-yne-1,2,3-triol |
|---|---|
| PubChem CID | 175708652 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2,3-bis(prop-2-ynyl)hex-5-yne-1,2,3-triol |
| SMILES | C#CCC(O)(CO)C(O)(CC#C)CC#C |
| InChI | InChI=1S/C12H14O3/c1-4-7-11(14,8-5-2)12(15,10-13)9-6-3/h1-3,13-15H,7-10H2 |
| InChIKey | XBVKZNSXRVAPOX-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|