C6H8F6O2 — CID 159965260
5,5,5-trifluoro-2-(trifluoromethyl)pentane-1,2-diol (PubChem CID 159965260) has the molecular formula C6H8F6O2 and a molecular weight of 226.12 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-(trifluoromethyl)pentane-1,2-diol.
| Compound Name | 5,5,5-trifluoro-2-(trifluoromethyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 159965260 |
| Molecular Formula | C6H8F6O2 |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 5,5,5-trifluoro-2-(trifluoromethyl)pentane-1,2-diol |
| SMILES | OCC(O)(CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6O2/c7-5(8,9)2-1-4(14,3-13)6(10,11)12/h13-14H,1-3H2 |
| InChIKey | ZZDIUKUNJLAPNV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |