About 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate
4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate (PubChem CID 145295362) has the molecular formula C23H31NO3
and a molecular weight of 369.50 g/mol. Its IUPAC name is 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate.
Molecular Properties
| Compound Name | 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate |
| PubChem CID | 145295362 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate |
| SMILES | CCCCCOc1ccc(-c2ccc(C(=O)OCCCCNC)cc2)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-3-4-6-17-26-22-14-12-20(13-15-22)19-8-10-21(11-9-19)23(25)27-18-7-5-16-24-2/h8-15,24H,3-7,16-18H2,1-2H3 |
| InChIKey | IWEGWMLMTGTEFV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate?
The IUPAC name of 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate (CID 145295362) is 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate.
What is the SMILES notation for 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate?
The canonical SMILES for 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate is CCCCCOc1ccc(-c2ccc(C(=O)OCCCCNC)cc2)cc1.
What is the InChIKey of 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate?
The InChIKey is IWEGWMLMTGTEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO3/c1-3-4-6-17-26-22-14-12-20(13-15-22)19-8-10-21(11-9-19)23(25)27-18-7-5-16-24-2/h8-15,24H,3-7,16-18H2,1-2H3.
What are the key properties of 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate?
4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate has a molecular weight of 369.50 g/mol, XLogP of 5.08, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)butyl 4-(4-pentoxyphenyl)benzoate is sourced from PubChem (CID 145295362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).