About 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate
6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate (PubChem CID 101122641) has the molecular formula C30H38O5
and a molecular weight of 478.63 g/mol. Its IUPAC name is 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate.
Molecular Properties
| Compound Name | 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate |
| PubChem CID | 101122641 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate |
| SMILES | CC#CC(=O)OCCCCCCOC(=O)c1ccc(-c2ccc(OCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C30H38O5/c1-3-5-6-7-10-22-33-28-20-18-26(19-21-28)25-14-16-27(17-15-25)30(32)35-24-12-9-8-11-23-34-29(31)13-4-2/h14-21H,3,5-12,22-24H2,1-2H3 |
| InChIKey | NBKSKLDTODKIOH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate?
The IUPAC name of 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate (CID 101122641) is 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate.
What is the SMILES notation for 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate?
The canonical SMILES for 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate is CC#CC(=O)OCCCCCCOC(=O)c1ccc(-c2ccc(OCCCCCCC)cc2)cc1.
What is the InChIKey of 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate?
The InChIKey is NBKSKLDTODKIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H38O5/c1-3-5-6-7-10-22-33-28-20-18-26(19-21-28)25-14-16-27(17-15-25)30(32)35-24-12-9-8-11-23-34-29(31)13-4-2/h14-21H,3,5-12,22-24H2,1-2H3.
What are the key properties of 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate?
6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate has a molecular weight of 478.63 g/mol, XLogP of 6.99, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-2-ynoyloxyhexyl 4-(4-heptoxyphenyl)benzoate is sourced from PubChem (CID 101122641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).