About [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate
[4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate (PubChem CID 58021160) has the molecular formula C19H14O4
and a molecular weight of 306.32 g/mol. Its IUPAC name is [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate.
Molecular Properties
| Compound Name | [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate |
| PubChem CID | 58021160 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate |
| SMILES | C=COCOc1ccc(-c2ccc(OC(=O)C3=C=C3)cc2)cc1 |
| InChI | InChI=1S/C19H14O4/c1-2-21-13-22-17-9-5-14(6-10-17)15-7-11-18(12-8-15)23-19(20)16-3-4-16/h2-3,5-12H,1,13H2 |
| InChIKey | AFSCALWWKGHXOX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate?
The IUPAC name of [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate (CID 58021160) is [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate.
What is the SMILES notation for [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate?
The canonical SMILES for [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate is C=COCOc1ccc(-c2ccc(OC(=O)C3=C=C3)cc2)cc1.
What is the InChIKey of [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate?
The InChIKey is AFSCALWWKGHXOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O4/c1-2-21-13-22-17-9-5-14(6-10-17)15-7-11-18(12-8-15)23-19(20)16-3-4-16/h2-3,5-12H,1,13H2.
What are the key properties of [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate?
[4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate has a molecular weight of 306.32 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(ethenoxymethoxy)phenyl]phenyl] cyclopropa-1,2-diene-1-carboxylate is sourced from PubChem (CID 58021160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).