C15H16O2S3 — CID 135224192
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 2,2-dimethylbutanoate (PubChem CID 135224192) has the molecular formula C15H16O2S3 and a molecular weight of 324.49 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 135224192 |
| Molecular Formula | C15H16O2S3 |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(-c2cc(=S)ss2)cc1 |
| InChI | InChI=1S/C15H16O2S3/c1-4-15(2,3)14(16)17-11-7-5-10(6-8-11)12-9-13(18)20-19-12/h5-9H,4H2,1-3H3 |
| InChIKey | GVAYODJEYNXQLH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|