C35H44O4 — CID 89467801
[4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2,2-dimethylpropanoyl)benzoate (PubChem CID 89467801) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is [4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2,2-dimethylpropanoyl)benzoate.
| Compound Name | [4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2,2-dimethylpropanoyl)benzoate |
|---|---|
| PubChem CID | 89467801 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | [4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2,2-dimethylpropanoyl)benzoate |
| SMILES | CCCC(C)(C)Oc1ccc(C(C)(CCC)c2ccc(OC(=O)c3cccc(C(=O)C(C)(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C35H44O4/c1-9-22-34(6,7)39-30-20-16-28(17-21-30)35(8,23-10-2)27-14-18-29(19-15-27)38-32(37)26-13-11-12-25(24-26)31(36)33(3,4)5/h11-21,24H,9-10,22-23H2,1-8H3 |
| InChIKey | MYJHSIHFCUNHDL-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|