C26H38O3 — CID 134238929
(6E,8E)-9-[4-(2,2-dimethylbutanoyl)phenoxy]-4-ethyl-4,6-dimethyldeca-6,8-dien-5-one (PubChem CID 134238929) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (6E,8E)-9-[4-(2,2-dimethylbutanoyl)phenoxy]-4-ethyl-4,6-dimethyldeca-6,8-dien-5-one.
| Compound Name | (6E,8E)-9-[4-(2,2-dimethylbutanoyl)phenoxy]-4-ethyl-4,6-dimethyldeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 134238929 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (6E,8E)-9-[4-(2,2-dimethylbutanoyl)phenoxy]-4-ethyl-4,6-dimethyldeca-6,8-dien-5-one |
| SMILES | CCCC(C)(CC)C(=O)/C(C)=C/C=C(\C)Oc1ccc(C(=O)C(C)(C)CC)cc1 |
| InChI | InChI=1S/C26H38O3/c1-9-18-26(8,11-3)23(27)19(4)12-13-20(5)29-22-16-14-21(15-17-22)24(28)25(6,7)10-2/h12-17H,9-11,18H2,1-8H3/b19-12+,20-13+ |
| InChIKey | ULKRPGNJFWWKAX-KVOOEGMKSA-N |
| XLogP | 7.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|