C20H22O4 — CID 70962727
4-[4-(2-ethyl-2-methylbutanoyl)phenoxy]benzoic acid (PubChem CID 70962727) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-[4-(2-ethyl-2-methylbutanoyl)phenoxy]benzoic acid.
| Compound Name | 4-[4-(2-ethyl-2-methylbutanoyl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 70962727 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[4-(2-ethyl-2-methylbutanoyl)phenoxy]benzoic acid |
| SMILES | CCC(C)(CC)C(=O)c1ccc(Oc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H22O4/c1-4-20(3,5-2)18(21)14-6-10-16(11-7-14)24-17-12-8-15(9-13-17)19(22)23/h6-13H,4-5H2,1-3H3,(H,22,23) |
| InChIKey | YXJJJSRFLQQIFM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |