C32H30O6 — CID 23140752
4-[4-[2-[4-(4-carboxyphenoxy)-3-methylphenyl]butan-2-yl]-2-methylphenoxy]benzoic acid (PubChem CID 23140752) has the molecular formula C32H30O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-carboxyphenoxy)-3-methylphenyl]butan-2-yl]-2-methylphenoxy]benzoic acid.
| Compound Name | 4-[4-[2-[4-(4-carboxyphenoxy)-3-methylphenyl]butan-2-yl]-2-methylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 23140752 |
| Molecular Formula | C32H30O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 4-[4-[2-[4-(4-carboxyphenoxy)-3-methylphenyl]butan-2-yl]-2-methylphenoxy]benzoic acid |
| SMILES | CCC(C)(c1ccc(Oc2ccc(C(=O)O)cc2)c(C)c1)c1ccc(Oc2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C32H30O6/c1-5-32(4,24-10-16-28(20(2)18-24)37-26-12-6-22(7-13-26)30(33)34)25-11-17-29(21(3)19-25)38-27-14-8-23(9-15-27)31(35)36/h6-19H,5H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | HPFAMYIIUOTWTI-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |