C38H40F6O10S3 — CID 88589131
5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid (PubChem CID 88589131) has the molecular formula C38H40F6O10S3 and a molecular weight of 866.92 g/mol. Its IUPAC name is 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid.
| Compound Name | 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88589131 |
| Molecular Formula | C38H40F6O10S3 |
| Molecular Weight | 866.92 g/mol |
| Exact Mass | 866.17 |
| IUPAC Name | 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid |
| SMILES | CCC(C)(C)Oc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(CC)CC)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H40F6O10S3/c1-7-34(4,5)54-27-16-12-25(13-17-27)36(37(39,40)41,38(42,43)44)24-10-14-26(15-11-24)53-31-21-19-29(23-33(31)57(50,51)52)55(45,46)28-18-20-30(35(6,8-2)9-3)32(22-28)56(47,48)49/h10-23H,7-9H2,1-6H3,(H,47,48,49)(H,50,51,52) |
| InChIKey | ISVAXVXXYYKPSL-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.92 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|