C29H36O10S3 — CID 89031187
2-(2-methylbutan-2-yl)-5-[4-[4-(3-methylpentan-3-yloxy)phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid (PubChem CID 89031187) has the molecular formula C29H36O10S3 and a molecular weight of 640.80 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-5-[4-[4-(3-methylpentan-3-yloxy)phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 2-(2-methylbutan-2-yl)-5-[4-[4-(3-methylpentan-3-yloxy)phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89031187 |
| Molecular Formula | C29H36O10S3 |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-5-[4-[4-(3-methylpentan-3-yloxy)phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid |
| SMILES | CCC(C)(CC)Oc1ccc(Oc2ccc(S(=O)(=O)c3ccc(C(C)(C)CC)c(S(=O)(=O)O)c3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C29H36O10S3/c1-7-28(4,5)24-16-14-22(18-26(24)41(32,33)34)40(30,31)23-15-17-25(27(19-23)42(35,36)37)38-20-10-12-21(13-11-20)39-29(6,8-2)9-3/h10-19H,7-9H2,1-6H3,(H,32,33,34)(H,35,36,37) |
| InChIKey | SLNKWZSDFKYGSE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|