C34H36O9S2 — CID 89031179
5-[4-[4-(4-butan-2-yloxyphenyl)phenoxy]-3-sulfobenzoyl]-2-(2-methylbutan-2-yl)benzenesulfonic acid (PubChem CID 89031179) has the molecular formula C34H36O9S2 and a molecular weight of 652.79 g/mol. Its IUPAC name is 5-[4-[4-(4-butan-2-yloxyphenyl)phenoxy]-3-sulfobenzoyl]-2-(2-methylbutan-2-yl)benzenesulfonic acid.
| Compound Name | 5-[4-[4-(4-butan-2-yloxyphenyl)phenoxy]-3-sulfobenzoyl]-2-(2-methylbutan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89031179 |
| Molecular Formula | C34H36O9S2 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | 5-[4-[4-(4-butan-2-yloxyphenyl)phenoxy]-3-sulfobenzoyl]-2-(2-methylbutan-2-yl)benzenesulfonic acid |
| SMILES | CCC(C)Oc1ccc(-c2ccc(Oc3ccc(C(=O)c4ccc(C(C)(C)CC)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H36O9S2/c1-6-22(3)42-27-14-8-23(9-15-27)24-10-16-28(17-11-24)43-30-19-13-26(21-32(30)45(39,40)41)33(35)25-12-18-29(34(4,5)7-2)31(20-25)44(36,37)38/h8-22H,6-7H2,1-5H3,(H,36,37,38)(H,39,40,41) |
| InChIKey | FLLSKKPBJVLINE-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|