C9H12N2O6S — CID 57086230
carbamoyl 4-amino-2,5-dimethoxybenzenesulfonate (PubChem CID 57086230) has the molecular formula C9H12N2O6S and a molecular weight of 276.27 g/mol. Its IUPAC name is carbamoyl 4-amino-2,5-dimethoxybenzenesulfonate.
| Compound Name | carbamoyl 4-amino-2,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 57086230 |
| Molecular Formula | C9H12N2O6S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | carbamoyl 4-amino-2,5-dimethoxybenzenesulfonate |
| SMILES | COc1cc(S(=O)(=O)OC(N)=O)c(OC)cc1N |
| InChI | InChI=1S/C9H12N2O6S/c1-15-6-4-8(7(16-2)3-5(6)10)18(13,14)17-9(11)12/h3-4H,10H2,1-2H3,(H2,11,12) |
| InChIKey | CGCFKZRCVXHKDX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|