C12H20N2O5S — CID 139080694
4-amino-5-methoxy-2-methylbenzenesulfonate;morpholin-4-ium (PubChem CID 139080694) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-amino-5-methoxy-2-methylbenzenesulfonate;morpholin-4-ium.
| Compound Name | 4-amino-5-methoxy-2-methylbenzenesulfonate;morpholin-4-ium |
|---|---|
| PubChem CID | 139080694 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-amino-5-methoxy-2-methylbenzenesulfonate;morpholin-4-ium |
| SMILES | C1COCC[NH2+]1.COc1cc(S(=O)(=O)[O-])c(C)cc1N |
| InChI | InChI=1S/C8H11NO4S.C4H9NO/c1-5-3-6(9)7(13-2)4-8(5)14(10,11)12;1-3-6-4-2-5-1/h3-4H,9H2,1-2H3,(H,10,11,12);5H,1-4H2 |
| InChIKey | ZLFVXCXFBQTQNF-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|