C9H14N2O4S — CID 57266401
N-(4-amino-2,5-dimethoxyphenyl)methanesulfonamide (PubChem CID 57266401) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethoxyphenyl)methanesulfonamide.
| Compound Name | N-(4-amino-2,5-dimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 57266401 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(4-amino-2,5-dimethoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(NS(C)(=O)=O)c(OC)cc1N |
| InChI | InChI=1S/C9H14N2O4S/c1-14-8-5-7(11-16(3,12)13)9(15-2)4-6(8)10/h4-5,11H,10H2,1-3H3 |
| InChIKey | ZALRSLMBNQREOA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|